C16H14ClNOS — CID 71372658
3-(3-chlorophenyl)-5-methyl-2-phenyl-1,3-thiazolidin-4-one (PubChem CID 71372658) has the molecular formula C16H14ClNOS and a molecular weight of 303.81 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-5-methyl-2-phenyl-1,3-thiazolidin-4-one.
| Compound Name | 3-(3-chlorophenyl)-5-methyl-2-phenyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 71372658 |
| Molecular Formula | C16H14ClNOS |
| Molecular Weight | 303.81 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 3-(3-chlorophenyl)-5-methyl-2-phenyl-1,3-thiazolidin-4-one |
| SMILES | CC1SC(c2ccccc2)N(c2cccc(Cl)c2)C1=O |
| InChI | InChI=1S/C16H14ClNOS/c1-11-15(19)18(14-9-5-8-13(17)10-14)16(20-11)12-6-3-2-4-7-12/h2-11,16H,1H3 |
| InChIKey | YPOHWWHAHXRCRD-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.81 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |