C18H16NO4S- — CID 4689601
3-[2-(4-methoxyphenyl)-5-methyl-4-oxo-1,3-thiazolidin-3-yl]benzoate (PubChem CID 4689601) has the molecular formula C18H16NO4S- and a molecular weight of 342.40 g/mol. Its IUPAC name is 3-[2-(4-methoxyphenyl)-5-methyl-4-oxo-1,3-thiazolidin-3-yl]benzoate.
| Compound Name | 3-[2-(4-methoxyphenyl)-5-methyl-4-oxo-1,3-thiazolidin-3-yl]benzoate |
|---|---|
| PubChem CID | 4689601 |
| Molecular Formula | C18H16NO4S- |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 3-[2-(4-methoxyphenyl)-5-methyl-4-oxo-1,3-thiazolidin-3-yl]benzoate |
| SMILES | COc1ccc(C2SC(C)C(=O)N2c2cccc(C(=O)[O-])c2)cc1 |
| InChI | InChI=1S/C18H17NO4S/c1-11-16(20)19(14-5-3-4-13(10-14)18(21)22)17(24-11)12-6-8-15(23-2)9-7-12/h3-11,17H,1-2H3,(H,21,22)/p-1 |
| InChIKey | CDAPDEHTTWYUPC-UHFFFAOYSA-M |
| XLogP | 2.23 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |