C35H36N2O5S2 — CID 139981616
3-[(2S,5S)-5-[2-[2-(3,4-dimethoxyphenyl)ethylsulfanyl]ethyl]-4-oxo-2-(4-phenylmethoxyphenyl)-1,3-thiazolidin-3-yl]benzamide (PubChem CID 139981616) has the molecular formula C35H36N2O5S2 and a molecular weight of 628.82 g/mol. Its IUPAC name is 3-[(2S,5S)-5-[2-[2-(3,4-dimethoxyphenyl)ethylsulfanyl]ethyl]-4-oxo-2-(4-phenylmethoxyphenyl)-1,3-thiazolidin-3-yl]benzamide.
| Compound Name | 3-[(2S,5S)-5-[2-[2-(3,4-dimethoxyphenyl)ethylsulfanyl]ethyl]-4-oxo-2-(4-phenylmethoxyphenyl)-1,3-thiazolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 139981616 |
| Molecular Formula | C35H36N2O5S2 |
| Molecular Weight | 628.82 g/mol |
| Exact Mass | 628.21 |
| IUPAC Name | 3-[(2S,5S)-5-[2-[2-(3,4-dimethoxyphenyl)ethylsulfanyl]ethyl]-4-oxo-2-(4-phenylmethoxyphenyl)-1,3-thiazolidin-3-yl]benzamide |
| SMILES | COc1ccc(CCSCC[C@@H]2S[C@@H](c3ccc(OCc4ccccc4)cc3)N(c3cccc(C(N)=O)c3)C2=O)cc1OC |
| InChI | InChI=1S/C35H36N2O5S2/c1-40-30-16-11-24(21-31(30)41-2)17-19-43-20-18-32-34(39)37(28-10-6-9-27(22-28)33(36)38)35(44-32)26-12-14-29(15-13-26)42-23-25-7-4-3-5-8-25/h3-16,21-22,32,35H,17-20,23H2,1-2H3,(H2,36,38)/t32-,35-/m0/s1 |
| InChIKey | MUPPWZWIHAQDAS-SHUZPENHSA-N |
| XLogP | 6.89 |
| TPSA | 91.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.82 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|