C28H27ClN4O7S — CID 10188890
3-[(2S,5R)-2-(4-chloro-3-nitrophenyl)-5-[2-[2-(3,4-dimethoxyphenyl)ethylamino]-2-oxoethyl]-4-oxo-1,3-thiazolidin-3-yl]benzamide (PubChem CID 10188890) has the molecular formula C28H27ClN4O7S and a molecular weight of 599.07 g/mol. Its IUPAC name is 3-[(2S,5R)-2-(4-chloro-3-nitrophenyl)-5-[2-[2-(3,4-dimethoxyphenyl)ethylamino]-2-oxoethyl]-4-oxo-1,3-thiazolidin-3-yl]benzamide.
| Compound Name | 3-[(2S,5R)-2-(4-chloro-3-nitrophenyl)-5-[2-[2-(3,4-dimethoxyphenyl)ethylamino]-2-oxoethyl]-4-oxo-1,3-thiazolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 10188890 |
| Molecular Formula | C28H27ClN4O7S |
| Molecular Weight | 599.07 g/mol |
| Exact Mass | 598.13 |
| IUPAC Name | 3-[(2S,5R)-2-(4-chloro-3-nitrophenyl)-5-[2-[2-(3,4-dimethoxyphenyl)ethylamino]-2-oxoethyl]-4-oxo-1,3-thiazolidin-3-yl]benzamide |
| SMILES | COc1ccc(CCNC(=O)C[C@H]2S[C@@H](c3ccc(Cl)c([N+](=O)[O-])c3)N(c3cccc(C(N)=O)c3)C2=O)cc1OC |
| InChI | InChI=1S/C28H27ClN4O7S/c1-39-22-9-6-16(12-23(22)40-2)10-11-31-25(34)15-24-27(36)32(19-5-3-4-17(13-19)26(30)35)28(41-24)18-7-8-20(29)21(14-18)33(37)38/h3-9,12-14,24,28H,10-11,15H2,1-2H3,(H2,30,35)(H,31,34)/t24-,28+/m1/s1 |
| InChIKey | LSYVYEPJVPGHSS-YWEHKCAJSA-N |
| XLogP | 4.26 |
| TPSA | 154.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.07 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|