C35H39N3O5S — CID 10282481
3-[(2S,5R)-5-[2-[2-(3-ethoxy-4-methoxyphenyl)ethylamino]-2-oxoethyl]-2-(4-hex-1-ynylphenyl)-4-oxo-1,3-thiazolidin-3-yl]benzamide (PubChem CID 10282481) has the molecular formula C35H39N3O5S and a molecular weight of 613.78 g/mol. Its IUPAC name is 3-[(2S,5R)-5-[2-[2-(3-ethoxy-4-methoxyphenyl)ethylamino]-2-oxoethyl]-2-(4-hex-1-ynylphenyl)-4-oxo-1,3-thiazolidin-3-yl]benzamide.
| Compound Name | 3-[(2S,5R)-5-[2-[2-(3-ethoxy-4-methoxyphenyl)ethylamino]-2-oxoethyl]-2-(4-hex-1-ynylphenyl)-4-oxo-1,3-thiazolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 10282481 |
| Molecular Formula | C35H39N3O5S |
| Molecular Weight | 613.78 g/mol |
| Exact Mass | 613.26 |
| IUPAC Name | 3-[(2S,5R)-5-[2-[2-(3-ethoxy-4-methoxyphenyl)ethylamino]-2-oxoethyl]-2-(4-hex-1-ynylphenyl)-4-oxo-1,3-thiazolidin-3-yl]benzamide |
| SMILES | CCCCC#Cc1ccc([C@@H]2S[C@H](CC(=O)NCCc3ccc(OC)c(OCC)c3)C(=O)N2c2cccc(C(N)=O)c2)cc1 |
| InChI | InChI=1S/C35H39N3O5S/c1-4-6-7-8-10-24-13-16-26(17-14-24)35-38(28-12-9-11-27(22-28)33(36)40)34(41)31(44-35)23-32(39)37-20-19-25-15-18-29(42-3)30(21-25)43-5-2/h9,11-18,21-22,31,35H,4-7,19-20,23H2,1-3H3,(H2,36,40)(H,37,39)/t31-,35+/m1/s1 |
| InChIKey | GBZZEYKCHDYVAK-NQVJXQQZSA-N |
| XLogP | 5.63 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.78 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|