C22H28O4S — CID 71378342
methyl 4-(2-hexyl-4,5-dimethylphenyl)sulfonylbenzoate (PubChem CID 71378342) has the molecular formula C22H28O4S and a molecular weight of 388.53 g/mol. Its IUPAC name is methyl 4-(2-hexyl-4,5-dimethylphenyl)sulfonylbenzoate.
| Compound Name | methyl 4-(2-hexyl-4,5-dimethylphenyl)sulfonylbenzoate |
|---|---|
| PubChem CID | 71378342 |
| Molecular Formula | C22H28O4S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | methyl 4-(2-hexyl-4,5-dimethylphenyl)sulfonylbenzoate |
| SMILES | CCCCCCc1cc(C)c(C)cc1S(=O)(=O)c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C22H28O4S/c1-5-6-7-8-9-19-14-16(2)17(3)15-21(19)27(24,25)20-12-10-18(11-13-20)22(23)26-4/h10-15H,5-9H2,1-4H3 |
| InChIKey | WCSVDGRTCIQPJU-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|