About trimethyl(tridec-1-en-3,5-diynyl)silane
trimethyl(tridec-1-en-3,5-diynyl)silane (PubChem CID 71378358) has the molecular formula C16H26Si
and a molecular weight of 246.47 g/mol. Its IUPAC name is trimethyl(tridec-1-en-3,5-diynyl)silane.
Molecular Properties
| Compound Name | trimethyl(tridec-1-en-3,5-diynyl)silane |
| PubChem CID | 71378358 |
| Molecular Formula | C16H26Si |
| Molecular Weight | 246.47 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | trimethyl(tridec-1-en-3,5-diynyl)silane |
| SMILES | CCCCCCCC#CC#CC=C[Si](C)(C)C |
| InChI | InChI=1S/C16H26Si/c1-5-6-7-8-9-10-11-12-13-14-15-16-17(2,3)4/h15-16H,5-10H2,1-4H3 |
| InChIKey | MIVJKZWOSATDIP-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.47 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze trimethyl(tridec-1-en-3,5-diynyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl(tridec-1-en-3,5-diynyl)silane?
The IUPAC name of trimethyl(tridec-1-en-3,5-diynyl)silane (CID 71378358) is trimethyl(tridec-1-en-3,5-diynyl)silane.
What is the SMILES notation for trimethyl(tridec-1-en-3,5-diynyl)silane?
The canonical SMILES for trimethyl(tridec-1-en-3,5-diynyl)silane is CCCCCCCC#CC#CC=C[Si](C)(C)C.
What is the InChIKey of trimethyl(tridec-1-en-3,5-diynyl)silane?
The InChIKey is MIVJKZWOSATDIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26Si/c1-5-6-7-8-9-10-11-12-13-14-15-16-17(2,3)4/h15-16H,5-10H2,1-4H3.
What are the key properties of trimethyl(tridec-1-en-3,5-diynyl)silane?
trimethyl(tridec-1-en-3,5-diynyl)silane has a molecular weight of 246.47 g/mol, XLogP of 4.79, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl(tridec-1-en-3,5-diynyl)silane is sourced from PubChem (CID 71378358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).