C14H20F2Si — CID 71378698
tert-butyl-difluoro-(5,6,7,8-tetrahydronaphthalen-2-yl)silane (PubChem CID 71378698) has the molecular formula C14H20F2Si and a molecular weight of 254.40 g/mol. Its IUPAC name is tert-butyl-difluoro-(5,6,7,8-tetrahydronaphthalen-2-yl)silane.
| Compound Name | tert-butyl-difluoro-(5,6,7,8-tetrahydronaphthalen-2-yl)silane |
|---|---|
| PubChem CID | 71378698 |
| Molecular Formula | C14H20F2Si |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | tert-butyl-difluoro-(5,6,7,8-tetrahydronaphthalen-2-yl)silane |
| SMILES | CC(C)(C)[Si](F)(F)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C14H20F2Si/c1-14(2,3)17(15,16)13-9-8-11-6-4-5-7-12(11)10-13/h8-10H,4-7H2,1-3H3 |
| InChIKey | IUUFTSUGWDEDPO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|