C29H29N3O3 — CID 7137888
3-[(4-benzhydrylpiperazin-1-yl)methyl]-2-methyl-4-oxo-1H-quinoline-8-carboxylic acid (PubChem CID 7137888) has the molecular formula C29H29N3O3 and a molecular weight of 467.57 g/mol. Its IUPAC name is 3-[(4-benzhydrylpiperazin-1-yl)methyl]-2-methyl-4-oxo-1H-quinoline-8-carboxylic acid.
| Compound Name | 3-[(4-benzhydrylpiperazin-1-yl)methyl]-2-methyl-4-oxo-1H-quinoline-8-carboxylic acid |
|---|---|
| PubChem CID | 7137888 |
| Molecular Formula | C29H29N3O3 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 3-[(4-benzhydrylpiperazin-1-yl)methyl]-2-methyl-4-oxo-1H-quinoline-8-carboxylic acid |
| SMILES | Cc1[nH]c2c(C(=O)O)cccc2c(=O)c1CN1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C29H29N3O3/c1-20-25(28(33)23-13-8-14-24(29(34)35)26(23)30-20)19-31-15-17-32(18-16-31)27(21-9-4-2-5-10-21)22-11-6-3-7-12-22/h2-14,27H,15-19H2,1H3,(H,30,33)(H,34,35) |
| InChIKey | YEPBDRYYERDBDS-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 76.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |