C17H30N2O5S — CID 71380307
7-[4-(3-hydroxyoctyl)-2,5-dioxo-1,3,4-thiadiazolidin-3-yl]heptanoic acid (PubChem CID 71380307) has the molecular formula C17H30N2O5S and a molecular weight of 374.50 g/mol. Its IUPAC name is 7-[4-(3-hydroxyoctyl)-2,5-dioxo-1,3,4-thiadiazolidin-3-yl]heptanoic acid.
| Compound Name | 7-[4-(3-hydroxyoctyl)-2,5-dioxo-1,3,4-thiadiazolidin-3-yl]heptanoic acid |
|---|---|
| PubChem CID | 71380307 |
| Molecular Formula | C17H30N2O5S |
| Molecular Weight | 374.50 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 7-[4-(3-hydroxyoctyl)-2,5-dioxo-1,3,4-thiadiazolidin-3-yl]heptanoic acid |
| SMILES | CCCCCC(O)CCn1c(=O)sc(=O)n1CCCCCCC(=O)O |
| InChI | InChI=1S/C17H30N2O5S/c1-2-3-6-9-14(20)11-13-19-17(24)25-16(23)18(19)12-8-5-4-7-10-15(21)22/h14,20H,2-13H2,1H3,(H,21,22) |
| InChIKey | FYKWGTWGHMWSQH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 101.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.50 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|