About (2-methylphenyl)arsonous acid
(2-methylphenyl)arsonous acid (PubChem CID 71382438) has the molecular formula C7H9AsO2
and a molecular weight of 200.07 g/mol. Its IUPAC name is (2-methylphenyl)arsonous acid.
Molecular Properties
| Compound Name | (2-methylphenyl)arsonous acid |
| PubChem CID | 71382438 |
| Molecular Formula | C7H9AsO2 |
| Molecular Weight | 200.07 g/mol |
| Exact Mass | 199.98 |
| IUPAC Name | (2-methylphenyl)arsonous acid |
| SMILES | Cc1ccccc1[As](O)O |
| InChI | InChI=1S/C7H9AsO2/c1-6-4-2-3-5-7(6)8(9)10/h2-5,9-10H,1H3 |
| InChIKey | CJFPARXFMBITAC-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.07 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2-methylphenyl)arsonous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylphenyl)arsonous acid?
The IUPAC name of (2-methylphenyl)arsonous acid (CID 71382438) is (2-methylphenyl)arsonous acid.
What is the SMILES notation for (2-methylphenyl)arsonous acid?
The canonical SMILES for (2-methylphenyl)arsonous acid is Cc1ccccc1[As](O)O.
What is the InChIKey of (2-methylphenyl)arsonous acid?
The InChIKey is CJFPARXFMBITAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9AsO2/c1-6-4-2-3-5-7(6)8(9)10/h2-5,9-10H,1H3.
What are the key properties of (2-methylphenyl)arsonous acid?
(2-methylphenyl)arsonous acid has a molecular weight of 200.07 g/mol, XLogP of -0.33, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylphenyl)arsonous acid is sourced from PubChem (CID 71382438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).