C18H28O3 — CID 71383868
(5,5-diethoxy-4-propan-2-yloxypent-3-enyl)benzene (PubChem CID 71383868) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is (5,5-diethoxy-4-propan-2-yloxypent-3-enyl)benzene.
| Compound Name | (5,5-diethoxy-4-propan-2-yloxypent-3-enyl)benzene |
|---|---|
| PubChem CID | 71383868 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | (5,5-diethoxy-4-propan-2-yloxypent-3-enyl)benzene |
| SMILES | CCOC(OCC)C(=CCCc1ccccc1)OC(C)C |
| InChI | InChI=1S/C18H28O3/c1-5-19-18(20-6-2)17(21-15(3)4)14-10-13-16-11-8-7-9-12-16/h7-9,11-12,14-15,18H,5-6,10,13H2,1-4H3 |
| InChIKey | WBZPEMBXDSDWDQ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|