About acetic acid;2-[(8S,9S)-9-prop-2-ynyl-1,4-dioxaspiro[4.4]nonan-8-yl]ethanol
acetic acid;2-[(8S,9S)-9-prop-2-ynyl-1,4-dioxaspiro[4.4]nonan-8-yl]ethanol (PubChem CID 71384523) has the molecular formula C14H22O5
and a molecular weight of 270.32 g/mol. Its IUPAC name is acetic acid;2-[(8S,9S)-9-prop-2-ynyl-1,4-dioxaspiro[4.4]nonan-8-yl]ethanol.
Molecular Properties
| Compound Name | acetic acid;2-[(8S,9S)-9-prop-2-ynyl-1,4-dioxaspiro[4.4]nonan-8-yl]ethanol |
| PubChem CID | 71384523 |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | acetic acid;2-[(8S,9S)-9-prop-2-ynyl-1,4-dioxaspiro[4.4]nonan-8-yl]ethanol |
| SMILES | C#CC[C@H]1[C@H](CCO)CCC12OCCO2.CC(=O)O |
| InChI | InChI=1S/C12H18O3.C2H4O2/c1-2-3-11-10(5-7-13)4-6-12(11)14-8-9-15-12;1-2(3)4/h1,10-11,13H,3-9H2;1H3,(H,3,4)/t10-,11-;/m0./s1 |
| InChIKey | WARCDNLHRJIQCQ-ACMTZBLWSA-N |
| XLogP | 1.25 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;2-[(8S,9S)-9-prop-2-ynyl-1,4-dioxaspiro[4.4]nonan-8-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;2-[(8S,9S)-9-prop-2-ynyl-1,4-dioxaspiro[4.4]nonan-8-yl]ethanol?
The IUPAC name of acetic acid;2-[(8S,9S)-9-prop-2-ynyl-1,4-dioxaspiro[4.4]nonan-8-yl]ethanol (CID 71384523) is acetic acid;2-[(8S,9S)-9-prop-2-ynyl-1,4-dioxaspiro[4.4]nonan-8-yl]ethanol.
What is the SMILES notation for acetic acid;2-[(8S,9S)-9-prop-2-ynyl-1,4-dioxaspiro[4.4]nonan-8-yl]ethanol?
The canonical SMILES for acetic acid;2-[(8S,9S)-9-prop-2-ynyl-1,4-dioxaspiro[4.4]nonan-8-yl]ethanol is C#CC[C@H]1[C@H](CCO)CCC12OCCO2.CC(=O)O.
What is the InChIKey of acetic acid;2-[(8S,9S)-9-prop-2-ynyl-1,4-dioxaspiro[4.4]nonan-8-yl]ethanol?
The InChIKey is WARCDNLHRJIQCQ-ACMTZBLWSA-N. The full InChI is InChI=1S/C12H18O3.C2H4O2/c1-2-3-11-10(5-7-13)4-6-12(11)14-8-9-15-12;1-2(3)4/h1,10-11,13H,3-9H2;1H3,(H,3,4)/t10-,11-;/m0./s1.
What are the key properties of acetic acid;2-[(8S,9S)-9-prop-2-ynyl-1,4-dioxaspiro[4.4]nonan-8-yl]ethanol?
acetic acid;2-[(8S,9S)-9-prop-2-ynyl-1,4-dioxaspiro[4.4]nonan-8-yl]ethanol has a molecular weight of 270.32 g/mol, XLogP of 1.25, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;2-[(8S,9S)-9-prop-2-ynyl-1,4-dioxaspiro[4.4]nonan-8-yl]ethanol is sourced from PubChem (CID 71384523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).