C16H26O2 — CID 71386545
7-ethenyl-2,2,9,9-tetramethyldec-4-ene-3,8-dione (PubChem CID 71386545) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is 7-ethenyl-2,2,9,9-tetramethyldec-4-ene-3,8-dione.
| Compound Name | 7-ethenyl-2,2,9,9-tetramethyldec-4-ene-3,8-dione |
|---|---|
| PubChem CID | 71386545 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 7-ethenyl-2,2,9,9-tetramethyldec-4-ene-3,8-dione |
| SMILES | C=CC(CC=CC(=O)C(C)(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C16H26O2/c1-8-12(14(18)16(5,6)7)10-9-11-13(17)15(2,3)4/h8-9,11-12H,1,10H2,2-7H3 |
| InChIKey | WCGBLQHZXMQHBO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|