C22H25N3O — CID 713872
3-(3,4-dimethylphenyl)imino-1-(piperidin-1-ylmethyl)indol-2-one (PubChem CID 713872) has the molecular formula C22H25N3O and a molecular weight of 347.46 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)imino-1-(piperidin-1-ylmethyl)indol-2-one.
| Compound Name | 3-(3,4-dimethylphenyl)imino-1-(piperidin-1-ylmethyl)indol-2-one |
|---|---|
| PubChem CID | 713872 |
| Molecular Formula | C22H25N3O |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 3-(3,4-dimethylphenyl)imino-1-(piperidin-1-ylmethyl)indol-2-one |
| SMILES | Cc1ccc(/N=C2\C(=O)N(CN3CCCCC3)c3ccccc32)cc1C |
| InChI | InChI=1S/C22H25N3O/c1-16-10-11-18(14-17(16)2)23-21-19-8-4-5-9-20(19)25(22(21)26)15-24-12-6-3-7-13-24/h4-5,8-11,14H,3,6-7,12-13,15H2,1-2H3/b23-21- |
| InChIKey | QSKHOCJEPDHSIP-LNVKXUELSA-N |
| XLogP | 4.21 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|