bis(2-methylpyrazine);perchloric acid

C10H13ClN4O4 — CID 71390131

IUPACbis(2-methylpyrazine);perchloric acid
SMILESCc1cnccn1.Cc1cnccn1.[O-][Cl+3]([O-])([O-])O
InChIInChI=1S/2C5H6N2.ClHO4/c2*1-5-4-6-2-3-7-5;2-1(3,4)5/h2*2-4H,1H3;(H,2,3,4,5)
InChIKeyROVBPTGIUGJZRE-UHFFFAOYSA-N
MW288.69 g/mol
LogP-2.55
Rot. Bonds

About bis(2-methylpyrazine);perchloric acid

bis(2-methylpyrazine);perchloric acid (PubChem CID 71390131) has the molecular formula C10H13ClN4O4 and a molecular weight of 288.69 g/mol. Its IUPAC name is bis(2-methylpyrazine);perchloric acid.

Molecular Properties

Compound Namebis(2-methylpyrazine);perchloric acid
PubChem CID71390131
Molecular FormulaC10H13ClN4O4
Molecular Weight288.69 g/mol
Exact Mass288.06
IUPAC Namebis(2-methylpyrazine);perchloric acid
SMILESCc1cnccn1.Cc1cnccn1.[O-][Cl+3]([O-])([O-])O
InChIInChI=1S/2C5H6N2.ClHO4/c2*1-5-4-6-2-3-7-5;2-1(3,4)5/h2*2-4H,1H3;(H,2,3,4,5)
InChIKeyROVBPTGIUGJZRE-UHFFFAOYSA-N
XLogP-2.55
TPSA140.97 Ų
H-Bond Donors1
H-Bond Acceptors8
Rotatable Bonds
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500288.69
LogP ≤ 5-2.55
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 108

Analyze bis(2-methylpyrazine);perchloric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of bis(2-methylpyrazine);perchloric acid?
The IUPAC name of bis(2-methylpyrazine);perchloric acid (CID 71390131) is bis(2-methylpyrazine);perchloric acid.
What is the SMILES notation for bis(2-methylpyrazine);perchloric acid?
The canonical SMILES for bis(2-methylpyrazine);perchloric acid is Cc1cnccn1.Cc1cnccn1.[O-][Cl+3]([O-])([O-])O.
What is the InChIKey of bis(2-methylpyrazine);perchloric acid?
The InChIKey is ROVBPTGIUGJZRE-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H6N2.ClHO4/c2*1-5-4-6-2-3-7-5;2-1(3,4)5/h2*2-4H,1H3;(H,2,3,4,5).
What are the key properties of bis(2-methylpyrazine);perchloric acid?
bis(2-methylpyrazine);perchloric acid has a molecular weight of 288.69 g/mol, XLogP of -2.55, 0 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methylpyrazine);perchloric acid is sourced from PubChem (CID 71390131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).