C10H13ClN4O4 — CID 71390131
bis(2-methylpyrazine);perchloric acid (PubChem CID 71390131) has the molecular formula C10H13ClN4O4 and a molecular weight of 288.69 g/mol. Its IUPAC name is bis(2-methylpyrazine);perchloric acid.
| Compound Name | bis(2-methylpyrazine);perchloric acid |
|---|---|
| PubChem CID | 71390131 |
| Molecular Formula | C10H13ClN4O4 |
| Molecular Weight | 288.69 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | bis(2-methylpyrazine);perchloric acid |
| SMILES | Cc1cnccn1.Cc1cnccn1.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/2C5H6N2.ClHO4/c2*1-5-4-6-2-3-7-5;2-1(3,4)5/h2*2-4H,1H3;(H,2,3,4,5) |
| InChIKey | ROVBPTGIUGJZRE-UHFFFAOYSA-N |
| XLogP | -2.55 |
| TPSA | 140.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.69 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |