C21H26O4 — CID 7139130
3-(2,4-dimethylphenoxy)-5-methoxy-4-pentoxybenzaldehyde (PubChem CID 7139130) has the molecular formula C21H26O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is 3-(2,4-dimethylphenoxy)-5-methoxy-4-pentoxybenzaldehyde.
| Compound Name | 3-(2,4-dimethylphenoxy)-5-methoxy-4-pentoxybenzaldehyde |
|---|---|
| PubChem CID | 7139130 |
| Molecular Formula | C21H26O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 3-(2,4-dimethylphenoxy)-5-methoxy-4-pentoxybenzaldehyde |
| SMILES | CCCCCOc1c(OC)cc(C=O)cc1Oc1ccc(C)cc1C |
| InChI | InChI=1S/C21H26O4/c1-5-6-7-10-24-21-19(23-4)12-17(14-22)13-20(21)25-18-9-8-15(2)11-16(18)3/h8-9,11-14H,5-7,10H2,1-4H3 |
| InChIKey | GAMXWHIZDKSLKF-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|