C15H15N3O3 — CID 71394096
N,N-dimethyl-4-[2-(3-nitrophenyl)oxaziridin-3-yl]aniline (PubChem CID 71394096) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is N,N-dimethyl-4-[2-(3-nitrophenyl)oxaziridin-3-yl]aniline.
| Compound Name | N,N-dimethyl-4-[2-(3-nitrophenyl)oxaziridin-3-yl]aniline |
|---|---|
| PubChem CID | 71394096 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | N,N-dimethyl-4-[2-(3-nitrophenyl)oxaziridin-3-yl]aniline |
| SMILES | CN(C)c1ccc(C2ON2c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C15H15N3O3/c1-16(2)12-8-6-11(7-9-12)15-17(21-15)13-4-3-5-14(10-13)18(19)20/h3-10,15H,1-2H3 |
| InChIKey | XOCWXVVWPYLEQA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 61.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|