C11H13Cl2O5P — CID 71394264
(2,4-dichloro-6-formylphenyl) diethyl phosphate (PubChem CID 71394264) has the molecular formula C11H13Cl2O5P and a molecular weight of 327.10 g/mol. Its IUPAC name is (2,4-dichloro-6-formylphenyl) diethyl phosphate.
| Compound Name | (2,4-dichloro-6-formylphenyl) diethyl phosphate |
|---|---|
| PubChem CID | 71394264 |
| Molecular Formula | C11H13Cl2O5P |
| Molecular Weight | 327.10 g/mol |
| Exact Mass | 325.99 |
| IUPAC Name | (2,4-dichloro-6-formylphenyl) diethyl phosphate |
| SMILES | CCOP(=O)(OCC)Oc1c(Cl)cc(Cl)cc1C=O |
| InChI | InChI=1S/C11H13Cl2O5P/c1-3-16-19(15,17-4-2)18-11-8(7-14)5-9(12)6-10(11)13/h5-7H,3-4H2,1-2H3 |
| InChIKey | WCIVYCCJHZKZEA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.10 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|