About (2,4-dichloro-6-formylphenyl) diethyl phosphate
(2,4-dichloro-6-formylphenyl) diethyl phosphate (PubChem CID 71394264) has the molecular formula C11H13Cl2O5P
and a molecular weight of 327.10 g/mol. Its IUPAC name is (2,4-dichloro-6-formylphenyl) diethyl phosphate.
Molecular Properties
| Compound Name | (2,4-dichloro-6-formylphenyl) diethyl phosphate |
| PubChem CID | 71394264 |
| Molecular Formula | C11H13Cl2O5P |
| Molecular Weight | 327.10 g/mol |
| Exact Mass | 325.99 |
| IUPAC Name | (2,4-dichloro-6-formylphenyl) diethyl phosphate |
| SMILES | CCOP(=O)(OCC)Oc1c(Cl)cc(Cl)cc1C=O |
| InChI | InChI=1S/C11H13Cl2O5P/c1-3-16-19(15,17-4-2)18-11-8(7-14)5-9(12)6-10(11)13/h5-7H,3-4H2,1-2H3 |
| InChIKey | WCIVYCCJHZKZEA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.10 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2,4-dichloro-6-formylphenyl) diethyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dichloro-6-formylphenyl) diethyl phosphate?
The IUPAC name of (2,4-dichloro-6-formylphenyl) diethyl phosphate (CID 71394264) is (2,4-dichloro-6-formylphenyl) diethyl phosphate.
What is the SMILES notation for (2,4-dichloro-6-formylphenyl) diethyl phosphate?
The canonical SMILES for (2,4-dichloro-6-formylphenyl) diethyl phosphate is CCOP(=O)(OCC)Oc1c(Cl)cc(Cl)cc1C=O.
What is the InChIKey of (2,4-dichloro-6-formylphenyl) diethyl phosphate?
The InChIKey is WCIVYCCJHZKZEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13Cl2O5P/c1-3-16-19(15,17-4-2)18-11-8(7-14)5-9(12)6-10(11)13/h5-7H,3-4H2,1-2H3.
What are the key properties of (2,4-dichloro-6-formylphenyl) diethyl phosphate?
(2,4-dichloro-6-formylphenyl) diethyl phosphate has a molecular weight of 327.10 g/mol, XLogP of 4.37, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dichloro-6-formylphenyl) diethyl phosphate is sourced from PubChem (CID 71394264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).