(2,4-dichloro-6-formylphenyl) trifluoromethanesulfonate

C8H3Cl2F3O4S — CID 87967925

IUPAC(2,4-dichloro-6-formylphenyl) trifluoromethanesulfonate
SMILESO=Cc1cc(Cl)cc(Cl)c1OS(=O)(=O)C(F)(F)F
InChIInChI=1S/C8H3Cl2F3O4S/c9-5-1-4(3-14)7(6(10)2-5)17-18(15,16)8(11,12)13/h1-3H
InChIKeyIXKJWHJRSAADMW-UHFFFAOYSA-N
MW323.08 g/mol
LogP3.03
Rot. Bonds3

About (2,4-dichloro-6-formylphenyl) trifluoromethanesulfonate

(2,4-dichloro-6-formylphenyl) trifluoromethanesulfonate (PubChem CID 87967925) has the molecular formula C8H3Cl2F3O4S and a molecular weight of 323.08 g/mol. Its IUPAC name is (2,4-dichloro-6-formylphenyl) trifluoromethanesulfonate.

Molecular Properties

Compound Name(2,4-dichloro-6-formylphenyl) trifluoromethanesulfonate
PubChem CID87967925
Molecular FormulaC8H3Cl2F3O4S
Molecular Weight323.08 g/mol
Exact Mass321.91
IUPAC Name(2,4-dichloro-6-formylphenyl) trifluoromethanesulfonate
SMILESO=Cc1cc(Cl)cc(Cl)c1OS(=O)(=O)C(F)(F)F
InChIInChI=1S/C8H3Cl2F3O4S/c9-5-1-4(3-14)7(6(10)2-5)17-18(15,16)8(11,12)13/h1-3H
InChIKeyIXKJWHJRSAADMW-UHFFFAOYSA-N
XLogP3.03
TPSA60.44 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500323.08
LogP ≤ 53.03
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}

Analyze (2,4-dichloro-6-formylphenyl) trifluoromethanesulfonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,4-dichloro-6-formylphenyl) trifluoromethanesulfonate?
The IUPAC name of (2,4-dichloro-6-formylphenyl) trifluoromethanesulfonate (CID 87967925) is (2,4-dichloro-6-formylphenyl) trifluoromethanesulfonate.
What is the SMILES notation for (2,4-dichloro-6-formylphenyl) trifluoromethanesulfonate?
The canonical SMILES for (2,4-dichloro-6-formylphenyl) trifluoromethanesulfonate is O=Cc1cc(Cl)cc(Cl)c1OS(=O)(=O)C(F)(F)F.
What is the InChIKey of (2,4-dichloro-6-formylphenyl) trifluoromethanesulfonate?
The InChIKey is IXKJWHJRSAADMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3Cl2F3O4S/c9-5-1-4(3-14)7(6(10)2-5)17-18(15,16)8(11,12)13/h1-3H.
What are the key properties of (2,4-dichloro-6-formylphenyl) trifluoromethanesulfonate?
(2,4-dichloro-6-formylphenyl) trifluoromethanesulfonate has a molecular weight of 323.08 g/mol, XLogP of 3.03, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dichloro-6-formylphenyl) trifluoromethanesulfonate is sourced from PubChem (CID 87967925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).