C13H18N2O — CID 71394330
3-(4-methoxyphenyl)-1,2,5-trimethyl-3H-pyrazole (PubChem CID 71394330) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-1,2,5-trimethyl-3H-pyrazole.
| Compound Name | 3-(4-methoxyphenyl)-1,2,5-trimethyl-3H-pyrazole |
|---|---|
| PubChem CID | 71394330 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 3-(4-methoxyphenyl)-1,2,5-trimethyl-3H-pyrazole |
| SMILES | COc1ccc(C2C=C(C)N(C)N2C)cc1 |
| InChI | InChI=1S/C13H18N2O/c1-10-9-13(15(3)14(10)2)11-5-7-12(16-4)8-6-11/h5-9,13H,1-4H3 |
| InChIKey | QENXZGWGMVMIIN-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |