C13H26S — CID 71394451
(3R,5R)-3,5-ditert-butylthiane (PubChem CID 71394451) has the molecular formula C13H26S and a molecular weight of 214.42 g/mol. Its IUPAC name is (3R,5R)-3,5-ditert-butylthiane.
| Compound Name | (3R,5R)-3,5-ditert-butylthiane |
|---|---|
| PubChem CID | 71394451 |
| Molecular Formula | C13H26S |
| Molecular Weight | 214.42 g/mol |
| Exact Mass | 214.18 |
| IUPAC Name | (3R,5R)-3,5-ditert-butylthiane |
| SMILES | CC(C)(C)[C@@H]1CSC[C@@H](C(C)(C)C)C1 |
| InChI | InChI=1S/C13H26S/c1-12(2,3)10-7-11(9-14-8-10)13(4,5)6/h10-11H,7-9H2,1-6H3/t10-,11-/m0/s1 |
| InChIKey | NBGANUNGLYXYRA-QWRGUYRKSA-N |
| XLogP | 4.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.42 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |