C13H9ClN4O8S — CID 71395264
N-[4-(chloromethylsulfonyl)-2,6-dinitrophenyl]-N-phenylnitramide (PubChem CID 71395264) has the molecular formula C13H9ClN4O8S and a molecular weight of 416.76 g/mol. Its IUPAC name is N-[4-(chloromethylsulfonyl)-2,6-dinitrophenyl]-N-phenylnitramide.
| Compound Name | N-[4-(chloromethylsulfonyl)-2,6-dinitrophenyl]-N-phenylnitramide |
|---|---|
| PubChem CID | 71395264 |
| Molecular Formula | C13H9ClN4O8S |
| Molecular Weight | 416.76 g/mol |
| Exact Mass | 415.98 |
| IUPAC Name | N-[4-(chloromethylsulfonyl)-2,6-dinitrophenyl]-N-phenylnitramide |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)CCl)cc([N+](=O)[O-])c1N(c1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/C13H9ClN4O8S/c14-8-27(25,26)10-6-11(16(19)20)13(12(7-10)17(21)22)15(18(23)24)9-4-2-1-3-5-9/h1-7H,8H2 |
| InChIKey | RVNGDECJXDUJBA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 166.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.76 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|