C18H16ClNO — CID 71397209
1-[(4-chlorophenyl)methyl]-4,7-dimethylquinolin-2-one (PubChem CID 71397209) has the molecular formula C18H16ClNO and a molecular weight of 297.79 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-4,7-dimethylquinolin-2-one.
| Compound Name | 1-[(4-chlorophenyl)methyl]-4,7-dimethylquinolin-2-one |
|---|---|
| PubChem CID | 71397209 |
| Molecular Formula | C18H16ClNO |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-4,7-dimethylquinolin-2-one |
| SMILES | Cc1ccc2c(C)cc(=O)n(Cc3ccc(Cl)cc3)c2c1 |
| InChI | InChI=1S/C18H16ClNO/c1-12-3-8-16-13(2)10-18(21)20(17(16)9-12)11-14-4-6-15(19)7-5-14/h3-10H,11H2,1-2H3 |
| InChIKey | WODSOGILKRJOGS-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |