C12H19BrO3 — CID 71398473
methyl 3-(1-bromo-3,3-dimethyl-2-oxocyclohexyl)propanoate (PubChem CID 71398473) has the molecular formula C12H19BrO3 and a molecular weight of 291.19 g/mol. Its IUPAC name is methyl 3-(1-bromo-3,3-dimethyl-2-oxocyclohexyl)propanoate.
| Compound Name | methyl 3-(1-bromo-3,3-dimethyl-2-oxocyclohexyl)propanoate |
|---|---|
| PubChem CID | 71398473 |
| Molecular Formula | C12H19BrO3 |
| Molecular Weight | 291.19 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | methyl 3-(1-bromo-3,3-dimethyl-2-oxocyclohexyl)propanoate |
| SMILES | COC(=O)CCC1(Br)CCCC(C)(C)C1=O |
| InChI | InChI=1S/C12H19BrO3/c1-11(2)6-4-7-12(13,10(11)15)8-5-9(14)16-3/h4-8H2,1-3H3 |
| InChIKey | YWVDWLOEIGQYIT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.19 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|