C14H22O3 — CID 15433055
1-(1,3,3-trimethyl-2-oxocyclohexyl)pentane-1,4-dione (PubChem CID 15433055) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is 1-(1,3,3-trimethyl-2-oxocyclohexyl)pentane-1,4-dione.
| Compound Name | 1-(1,3,3-trimethyl-2-oxocyclohexyl)pentane-1,4-dione |
|---|---|
| PubChem CID | 15433055 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | 1-(1,3,3-trimethyl-2-oxocyclohexyl)pentane-1,4-dione |
| SMILES | CC(=O)CCC(=O)C1(C)CCCC(C)(C)C1=O |
| InChI | InChI=1S/C14H22O3/c1-10(15)6-7-11(16)14(4)9-5-8-13(2,3)12(14)17/h5-9H2,1-4H3 |
| InChIKey | DBKNAIYCSLWFQM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|