C14H24O2 — CID 23256271
1-(1,2,2-trimethylcyclopentyl)hexane-1,5-dione (PubChem CID 23256271) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is 1-(1,2,2-trimethylcyclopentyl)hexane-1,5-dione.
| Compound Name | 1-(1,2,2-trimethylcyclopentyl)hexane-1,5-dione |
|---|---|
| PubChem CID | 23256271 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 1-(1,2,2-trimethylcyclopentyl)hexane-1,5-dione |
| SMILES | CC(=O)CCCC(=O)C1(C)CCCC1(C)C |
| InChI | InChI=1S/C14H24O2/c1-11(15)7-5-8-12(16)14(4)10-6-9-13(14,2)3/h5-10H2,1-4H3 |
| InChIKey | XCERZYSTKVVWRM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |