About 2,4-bis(ethenyl)-5-(hydroxymethyl)pyridin-3-ol;hydrochloride
2,4-bis(ethenyl)-5-(hydroxymethyl)pyridin-3-ol;hydrochloride (PubChem CID 71400941) has the molecular formula C10H12ClNO2
and a molecular weight of 213.66 g/mol. Its IUPAC name is 2,4-bis(ethenyl)-5-(hydroxymethyl)pyridin-3-ol;hydrochloride.
Molecular Properties
| Compound Name | 2,4-bis(ethenyl)-5-(hydroxymethyl)pyridin-3-ol;hydrochloride |
| PubChem CID | 71400941 |
| Molecular Formula | C10H12ClNO2 |
| Molecular Weight | 213.66 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 2,4-bis(ethenyl)-5-(hydroxymethyl)pyridin-3-ol;hydrochloride |
| SMILES | C=Cc1ncc(CO)c(C=C)c1O.Cl |
| InChI | InChI=1S/C10H11NO2.ClH/c1-3-8-7(6-12)5-11-9(4-2)10(8)13;/h3-5,12-13H,1-2,6H2;1H |
| InChIKey | UNPDDDOXEXHNDV-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.66 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-bis(ethenyl)-5-(hydroxymethyl)pyridin-3-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-bis(ethenyl)-5-(hydroxymethyl)pyridin-3-ol;hydrochloride?
The IUPAC name of 2,4-bis(ethenyl)-5-(hydroxymethyl)pyridin-3-ol;hydrochloride (CID 71400941) is 2,4-bis(ethenyl)-5-(hydroxymethyl)pyridin-3-ol;hydrochloride.
What is the SMILES notation for 2,4-bis(ethenyl)-5-(hydroxymethyl)pyridin-3-ol;hydrochloride?
The canonical SMILES for 2,4-bis(ethenyl)-5-(hydroxymethyl)pyridin-3-ol;hydrochloride is C=Cc1ncc(CO)c(C=C)c1O.Cl.
What is the InChIKey of 2,4-bis(ethenyl)-5-(hydroxymethyl)pyridin-3-ol;hydrochloride?
The InChIKey is UNPDDDOXEXHNDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2.ClH/c1-3-8-7(6-12)5-11-9(4-2)10(8)13;/h3-5,12-13H,1-2,6H2;1H.
What are the key properties of 2,4-bis(ethenyl)-5-(hydroxymethyl)pyridin-3-ol;hydrochloride?
2,4-bis(ethenyl)-5-(hydroxymethyl)pyridin-3-ol;hydrochloride has a molecular weight of 213.66 g/mol, XLogP of 1.99, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-bis(ethenyl)-5-(hydroxymethyl)pyridin-3-ol;hydrochloride is sourced from PubChem (CID 71400941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).