C22H46Sn — CID 71403532
tributyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]stannane (PubChem CID 71403532) has the molecular formula C22H46Sn and a molecular weight of 429.32 g/mol. Its IUPAC name is tributyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]stannane.
| Compound Name | tributyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]stannane |
|---|---|
| PubChem CID | 71403532 |
| Molecular Formula | C22H46Sn |
| Molecular Weight | 429.32 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | tributyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)[C@@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C10H19.3C4H9.Sn/c1-8(2)10-6-4-9(3)5-7-10;3*1-3-4-2;/h6,8-10H,4-5,7H2,1-3H3;3*1,3-4H2,2H3;/t9-,10-;;;;/m0..../s1 |
| InChIKey | KSZYEUNDJPZWEW-IJBXMQGASA-N |
| XLogP | 8.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.32 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |