C16H12NO4P — CID 71407350
2-(2-methylquinolin-8-yl)oxy-1,3,2λ5-benzodioxaphosphole 2-oxide (PubChem CID 71407350) has the molecular formula C16H12NO4P and a molecular weight of 313.25 g/mol. Its IUPAC name is 2-(2-methylquinolin-8-yl)oxy-1,3,2λ5-benzodioxaphosphole 2-oxide.
| Compound Name | 2-(2-methylquinolin-8-yl)oxy-1,3,2λ5-benzodioxaphosphole 2-oxide |
|---|---|
| PubChem CID | 71407350 |
| Molecular Formula | C16H12NO4P |
| Molecular Weight | 313.25 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 2-(2-methylquinolin-8-yl)oxy-1,3,2λ5-benzodioxaphosphole 2-oxide |
| SMILES | Cc1ccc2cccc(OP3(=O)Oc4ccccc4O3)c2n1 |
| InChI | InChI=1S/C16H12NO4P/c1-11-9-10-12-5-4-8-15(16(12)17-11)21-22(18)19-13-6-2-3-7-14(13)20-22/h2-10H,1H3 |
| InChIKey | YIGDGZXICAOXGK-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.25 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|