C12H14OS — CID 71408438
(3S,5S)-3-benzyl-5-methylthiolan-2-one (PubChem CID 71408438) has the molecular formula C12H14OS and a molecular weight of 206.31 g/mol. Its IUPAC name is (3S,5S)-3-benzyl-5-methylthiolan-2-one.
| Compound Name | (3S,5S)-3-benzyl-5-methylthiolan-2-one |
|---|---|
| PubChem CID | 71408438 |
| Molecular Formula | C12H14OS |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | (3S,5S)-3-benzyl-5-methylthiolan-2-one |
| SMILES | C[C@H]1C[C@H](Cc2ccccc2)C(=O)S1 |
| InChI | InChI=1S/C12H14OS/c1-9-7-11(12(13)14-9)8-10-5-3-2-4-6-10/h2-6,9,11H,7-8H2,1H3/t9-,11+/m0/s1 |
| InChIKey | KYTUYNXTCKAPFC-GXSJLCMTSA-N |
| XLogP | 2.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|