C22H18O3 — CID 11624075
4-benzyl-1-methyl-3,4-dihydro-1H-anthracene-2,9,10-trione (PubChem CID 11624075) has the molecular formula C22H18O3 and a molecular weight of 330.38 g/mol. Its IUPAC name is 4-benzyl-1-methyl-3,4-dihydro-1H-anthracene-2,9,10-trione.
| Compound Name | 4-benzyl-1-methyl-3,4-dihydro-1H-anthracene-2,9,10-trione |
|---|---|
| PubChem CID | 11624075 |
| Molecular Formula | C22H18O3 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 4-benzyl-1-methyl-3,4-dihydro-1H-anthracene-2,9,10-trione |
| SMILES | CC1C(=O)CC(Cc2ccccc2)C2=C1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C22H18O3/c1-13-18(23)12-15(11-14-7-3-2-4-8-14)20-19(13)21(24)16-9-5-6-10-17(16)22(20)25/h2-10,13,15H,11-12H2,1H3 |
| InChIKey | VSYMXPRECZJIDJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|