C24H10N4+2 — CID 71408620
coronene-1,2-didiazonium (PubChem CID 71408620) has the molecular formula C24H10N4+2 and a molecular weight of 354.37 g/mol. Its IUPAC name is coronene-1,2-didiazonium.
| Compound Name | coronene-1,2-didiazonium |
|---|---|
| PubChem CID | 71408620 |
| Molecular Formula | C24H10N4+2 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | coronene-1,2-didiazonium |
| SMILES | N#[N+]c1c([N+]#N)c2ccc3ccc4ccc5ccc6ccc1c1c6c5c4c3c21 |
| InChI | InChI=1S/C24H10N4/c25-27-23-15-9-7-13-5-3-11-1-2-12-4-6-14-8-10-16(24(23)28-26)22-20(14)18(12)17(11)19(13)21(15)22/h1-10H/q+2 |
| InChIKey | MRIKZJSQTBKDQN-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 56.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|