C24H8N2O4 — CID 102228646
4,13-diazaoctacyclo[17.5.2.02,6.07,23.010,22.011,15.016,21.020,24]hexacosa-1(24),2(6),7(23),8,10(22),11(15),16(21),17,19,25-decaene-3,5,12,14-tetrone (PubChem CID 102228646) has the molecular formula C24H8N2O4 and a molecular weight of 388.34 g/mol. Its IUPAC name is 4,13-diazaoctacyclo[17.5.2.02,6.07,23.010,22.011,15.016,21.020,24]hexacosa-1(24),2(6),7(23),8,10(22),11(15),16(21),17,19,25-decaene-3,5,12,14-tetrone.
| Compound Name | 4,13-diazaoctacyclo[17.5.2.02,6.07,23.010,22.011,15.016,21.020,24]hexacosa-1(24),2(6),7(23),8,10(22),11(15),16(21),17,19,25-decaene-3,5,12,14-tetrone |
|---|---|
| PubChem CID | 102228646 |
| Molecular Formula | C24H8N2O4 |
| Molecular Weight | 388.34 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | 4,13-diazaoctacyclo[17.5.2.02,6.07,23.010,22.011,15.016,21.020,24]hexacosa-1(24),2(6),7(23),8,10(22),11(15),16(21),17,19,25-decaene-3,5,12,14-tetrone |
| SMILES | O=c1[nH]c(=O)c2c3ccc4c5c(=O)[nH]c(=O)c5c5ccc6ccc(c12)c1c6c5c4c31 |
| InChI | InChI=1S/C24H8N2O4/c27-21-17-8-3-1-7-2-4-9-14-12(7)13(8)15-10(19(17)23(29)25-21)5-6-11(16(14)15)20-18(9)22(28)26-24(20)30/h1-6H,(H,25,27,29)(H,26,28,30) |
| InChIKey | CHSORFRIQBENFK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|