C24H8N2O4 — CID 102228647
7,15-diazaoctacyclo[11.11.1.15,22.02,11.03,23.04,9.017,25.019,24]hexacosa-1(24),2(11),3(23),4,9,12,17(25),18,20,22(26)-decaene-6,8,14,16-tetrone (PubChem CID 102228647) has the molecular formula C24H8N2O4 and a molecular weight of 388.34 g/mol. Its IUPAC name is 7,15-diazaoctacyclo[11.11.1.15,22.02,11.03,23.04,9.017,25.019,24]hexacosa-1(24),2(11),3(23),4,9,12,17(25),18,20,22(26)-decaene-6,8,14,16-tetrone.
| Compound Name | 7,15-diazaoctacyclo[11.11.1.15,22.02,11.03,23.04,9.017,25.019,24]hexacosa-1(24),2(11),3(23),4,9,12,17(25),18,20,22(26)-decaene-6,8,14,16-tetrone |
|---|---|
| PubChem CID | 102228647 |
| Molecular Formula | C24H8N2O4 |
| Molecular Weight | 388.34 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | 7,15-diazaoctacyclo[11.11.1.15,22.02,11.03,23.04,9.017,25.019,24]hexacosa-1(24),2(11),3(23),4,9,12,17(25),18,20,22(26)-decaene-6,8,14,16-tetrone |
| SMILES | O=c1[nH]c(=O)c2cc3cc4c(=O)[nH]c(=O)c5cc6ccc7cc1c2c1c7c6c(c54)c31 |
| InChI | InChI=1S/C24H8N2O4/c27-21-10-3-7-1-2-8-4-11-18-13(24(30)26-22(11)28)6-9-5-12(23(29)25-21)17(10)19-14(7)15(8)20(18)16(9)19/h1-6H,(H,25,27,29)(H,26,28,30) |
| InChIKey | LRNDXVRDNWWIBE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|