About (2-pentan-2-ylphenyl) N-prop-1-enylcarbamate
(2-pentan-2-ylphenyl) N-prop-1-enylcarbamate (PubChem CID 71409261) has the molecular formula C15H21NO2
and a molecular weight of 247.34 g/mol. Its IUPAC name is (2-pentan-2-ylphenyl) N-prop-1-enylcarbamate.
Molecular Properties
| Compound Name | (2-pentan-2-ylphenyl) N-prop-1-enylcarbamate |
| PubChem CID | 71409261 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | (2-pentan-2-ylphenyl) N-prop-1-enylcarbamate |
| SMILES | CC=CNC(=O)Oc1ccccc1C(C)CCC |
| InChI | InChI=1S/C15H21NO2/c1-4-8-12(3)13-9-6-7-10-14(13)18-15(17)16-11-5-2/h5-7,9-12H,4,8H2,1-3H3,(H,16,17) |
| InChIKey | VPBHKLUHIRXJSL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2-pentan-2-ylphenyl) N-prop-1-enylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-pentan-2-ylphenyl) N-prop-1-enylcarbamate?
The IUPAC name of (2-pentan-2-ylphenyl) N-prop-1-enylcarbamate (CID 71409261) is (2-pentan-2-ylphenyl) N-prop-1-enylcarbamate.
What is the SMILES notation for (2-pentan-2-ylphenyl) N-prop-1-enylcarbamate?
The canonical SMILES for (2-pentan-2-ylphenyl) N-prop-1-enylcarbamate is CC=CNC(=O)Oc1ccccc1C(C)CCC.
What is the InChIKey of (2-pentan-2-ylphenyl) N-prop-1-enylcarbamate?
The InChIKey is VPBHKLUHIRXJSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO2/c1-4-8-12(3)13-9-6-7-10-14(13)18-15(17)16-11-5-2/h5-7,9-12H,4,8H2,1-3H3,(H,16,17).
What are the key properties of (2-pentan-2-ylphenyl) N-prop-1-enylcarbamate?
(2-pentan-2-ylphenyl) N-prop-1-enylcarbamate has a molecular weight of 247.34 g/mol, XLogP of 4.21, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-pentan-2-ylphenyl) N-prop-1-enylcarbamate is sourced from PubChem (CID 71409261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).