C13H18O4 — CID 129186368
(2-butan-2-ylphenyl) 2,3-dihydroxypropanoate (PubChem CID 129186368) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is (2-butan-2-ylphenyl) 2,3-dihydroxypropanoate.
| Compound Name | (2-butan-2-ylphenyl) 2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 129186368 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | (2-butan-2-ylphenyl) 2,3-dihydroxypropanoate |
| SMILES | CCC(C)c1ccccc1OC(=O)C(O)CO |
| InChI | InChI=1S/C13H18O4/c1-3-9(2)10-6-4-5-7-12(10)17-13(16)11(15)8-14/h4-7,9,11,14-15H,3,8H2,1-2H3 |
| InChIKey | QRVJFTMKROXNLS-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|