About 2-heptoxyethyl 3-aminobut-2-enoate
2-heptoxyethyl 3-aminobut-2-enoate (PubChem CID 71409461) has the molecular formula C13H25NO3
and a molecular weight of 243.35 g/mol. Its IUPAC name is 2-heptoxyethyl 3-aminobut-2-enoate.
Molecular Properties
| Compound Name | 2-heptoxyethyl 3-aminobut-2-enoate |
| PubChem CID | 71409461 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | 2-heptoxyethyl 3-aminobut-2-enoate |
| SMILES | CCCCCCCOCCOC(=O)C=C(C)N |
| InChI | InChI=1S/C13H25NO3/c1-3-4-5-6-7-8-16-9-10-17-13(15)11-12(2)14/h11H,3-10,14H2,1-2H3 |
| InChIKey | JZFWTYAFWKHWKH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-heptoxyethyl 3-aminobut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-heptoxyethyl 3-aminobut-2-enoate?
The IUPAC name of 2-heptoxyethyl 3-aminobut-2-enoate (CID 71409461) is 2-heptoxyethyl 3-aminobut-2-enoate.
What is the SMILES notation for 2-heptoxyethyl 3-aminobut-2-enoate?
The canonical SMILES for 2-heptoxyethyl 3-aminobut-2-enoate is CCCCCCCOCCOC(=O)C=C(C)N.
What is the InChIKey of 2-heptoxyethyl 3-aminobut-2-enoate?
The InChIKey is JZFWTYAFWKHWKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO3/c1-3-4-5-6-7-8-16-9-10-17-13(15)11-12(2)14/h11H,3-10,14H2,1-2H3.
What are the key properties of 2-heptoxyethyl 3-aminobut-2-enoate?
2-heptoxyethyl 3-aminobut-2-enoate has a molecular weight of 243.35 g/mol, XLogP of 2.38, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-heptoxyethyl 3-aminobut-2-enoate is sourced from PubChem (CID 71409461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).