C10H6Cl4O — CID 71409950
4-(2,3,3-trichloroprop-2-enyl)benzoyl chloride (PubChem CID 71409950) has the molecular formula C10H6Cl4O and a molecular weight of 283.97 g/mol. Its IUPAC name is 4-(2,3,3-trichloroprop-2-enyl)benzoyl chloride.
| Compound Name | 4-(2,3,3-trichloroprop-2-enyl)benzoyl chloride |
|---|---|
| PubChem CID | 71409950 |
| Molecular Formula | C10H6Cl4O |
| Molecular Weight | 283.97 g/mol |
| Exact Mass | 281.92 |
| IUPAC Name | 4-(2,3,3-trichloroprop-2-enyl)benzoyl chloride |
| SMILES | O=C(Cl)c1ccc(CC(Cl)=C(Cl)Cl)cc1 |
| InChI | InChI=1S/C10H6Cl4O/c11-8(9(12)13)5-6-1-3-7(4-2-6)10(14)15/h1-4H,5H2 |
| InChIKey | GQDKJUPKKDSXJE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.97 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|