C17H20O3 — CID 71412058
2-acetyl-5-(2,4,6-trimethylphenyl)cyclohexane-1,3-dione (PubChem CID 71412058) has the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. Its IUPAC name is 2-acetyl-5-(2,4,6-trimethylphenyl)cyclohexane-1,3-dione.
| Compound Name | 2-acetyl-5-(2,4,6-trimethylphenyl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 71412058 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 2-acetyl-5-(2,4,6-trimethylphenyl)cyclohexane-1,3-dione |
| SMILES | CC(=O)C1C(=O)CC(c2c(C)cc(C)cc2C)CC1=O |
| InChI | InChI=1S/C17H20O3/c1-9-5-10(2)16(11(3)6-9)13-7-14(19)17(12(4)18)15(20)8-13/h5-6,13,17H,7-8H2,1-4H3 |
| InChIKey | KGWLQSZEIVHARM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|