C14H12N4O6 — CID 71413462
1-(4,5,7-trinitronaphthalen-1-yl)pyrrolidine (PubChem CID 71413462) has the molecular formula C14H12N4O6 and a molecular weight of 332.27 g/mol. Its IUPAC name is 1-(4,5,7-trinitronaphthalen-1-yl)pyrrolidine.
| Compound Name | 1-(4,5,7-trinitronaphthalen-1-yl)pyrrolidine |
|---|---|
| PubChem CID | 71413462 |
| Molecular Formula | C14H12N4O6 |
| Molecular Weight | 332.27 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 1-(4,5,7-trinitronaphthalen-1-yl)pyrrolidine |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c2c([N+](=O)[O-])ccc(N3CCCC3)c2c1 |
| InChI | InChI=1S/C14H12N4O6/c19-16(20)9-7-10-11(15-5-1-2-6-15)3-4-12(17(21)22)14(10)13(8-9)18(23)24/h3-4,7-8H,1-2,5-6H2 |
| InChIKey | IHNCBRWZYYBRHH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 132.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.27 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|