C13H14O3S — CID 71413686
3-(3-methylsulfanyl-4-prop-2-ynoxyphenyl)propanoic acid (PubChem CID 71413686) has the molecular formula C13H14O3S and a molecular weight of 250.32 g/mol. Its IUPAC name is 3-(3-methylsulfanyl-4-prop-2-ynoxyphenyl)propanoic acid.
| Compound Name | 3-(3-methylsulfanyl-4-prop-2-ynoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 71413686 |
| Molecular Formula | C13H14O3S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 3-(3-methylsulfanyl-4-prop-2-ynoxyphenyl)propanoic acid |
| SMILES | C#CCOc1ccc(CCC(=O)O)cc1SC |
| InChI | InChI=1S/C13H14O3S/c1-3-8-16-11-6-4-10(5-7-13(14)15)9-12(11)17-2/h1,4,6,9H,5,7-8H2,2H3,(H,14,15) |
| InChIKey | RIZGJZSLAZVIAF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|