About (4-bromo-2-formylphenyl) ditert-butyl phosphate
(4-bromo-2-formylphenyl) ditert-butyl phosphate (PubChem CID 71414096) has the molecular formula C15H22BrO5P
and a molecular weight of 393.21 g/mol. Its IUPAC name is (4-bromo-2-formylphenyl) ditert-butyl phosphate.
Molecular Properties
| Compound Name | (4-bromo-2-formylphenyl) ditert-butyl phosphate |
| PubChem CID | 71414096 |
| Molecular Formula | C15H22BrO5P |
| Molecular Weight | 393.21 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | (4-bromo-2-formylphenyl) ditert-butyl phosphate |
| SMILES | CC(C)(C)OP(=O)(Oc1ccc(Br)cc1C=O)OC(C)(C)C |
| InChI | InChI=1S/C15H22BrO5P/c1-14(2,3)20-22(18,21-15(4,5)6)19-13-8-7-12(16)9-11(13)10-17/h7-10H,1-6H3 |
| InChIKey | ACEKQFNKVYKRGL-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.21 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (4-bromo-2-formylphenyl) ditert-butyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromo-2-formylphenyl) ditert-butyl phosphate?
The IUPAC name of (4-bromo-2-formylphenyl) ditert-butyl phosphate (CID 71414096) is (4-bromo-2-formylphenyl) ditert-butyl phosphate.
What is the SMILES notation for (4-bromo-2-formylphenyl) ditert-butyl phosphate?
The canonical SMILES for (4-bromo-2-formylphenyl) ditert-butyl phosphate is CC(C)(C)OP(=O)(Oc1ccc(Br)cc1C=O)OC(C)(C)C.
What is the InChIKey of (4-bromo-2-formylphenyl) ditert-butyl phosphate?
The InChIKey is ACEKQFNKVYKRGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22BrO5P/c1-14(2,3)20-22(18,21-15(4,5)6)19-13-8-7-12(16)9-11(13)10-17/h7-10H,1-6H3.
What are the key properties of (4-bromo-2-formylphenyl) ditert-butyl phosphate?
(4-bromo-2-formylphenyl) ditert-butyl phosphate has a molecular weight of 393.21 g/mol, XLogP of 5.38, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromo-2-formylphenyl) ditert-butyl phosphate is sourced from PubChem (CID 71414096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).