C22H30NO3+ — CID 71418478
8-pyridin-1-ium-1-yloctyl (2S)-2-methoxy-2-phenylacetate (PubChem CID 71418478) has the molecular formula C22H30NO3+ and a molecular weight of 356.49 g/mol. Its IUPAC name is 8-pyridin-1-ium-1-yloctyl (2S)-2-methoxy-2-phenylacetate.
| Compound Name | 8-pyridin-1-ium-1-yloctyl (2S)-2-methoxy-2-phenylacetate |
|---|---|
| PubChem CID | 71418478 |
| Molecular Formula | C22H30NO3+ |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 8-pyridin-1-ium-1-yloctyl (2S)-2-methoxy-2-phenylacetate |
| SMILES | CO[C@H](C(=O)OCCCCCCCC[n+]1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H30NO3/c1-25-21(20-14-8-6-9-15-20)22(24)26-19-13-5-3-2-4-10-16-23-17-11-7-12-18-23/h6-9,11-12,14-15,17-18,21H,2-5,10,13,16,19H2,1H3/q+1/t21-/m0/s1 |
| InChIKey | HBZAXIVPQKDAGT-NRFANRHFSA-N |
| XLogP | 4.25 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|