C17H22O6 — CID 59857929
3-acetyl-6-(2-methoxy-2-phenylacetyl)oxyhexanoic acid (PubChem CID 59857929) has the molecular formula C17H22O6 and a molecular weight of 322.36 g/mol. Its IUPAC name is 3-acetyl-6-(2-methoxy-2-phenylacetyl)oxyhexanoic acid.
| Compound Name | 3-acetyl-6-(2-methoxy-2-phenylacetyl)oxyhexanoic acid |
|---|---|
| PubChem CID | 59857929 |
| Molecular Formula | C17H22O6 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 3-acetyl-6-(2-methoxy-2-phenylacetyl)oxyhexanoic acid |
| SMILES | COC(C(=O)OCCCC(CC(=O)O)C(C)=O)c1ccccc1 |
| InChI | InChI=1S/C17H22O6/c1-12(18)14(11-15(19)20)9-6-10-23-17(21)16(22-2)13-7-4-3-5-8-13/h3-5,7-8,14,16H,6,9-11H2,1-2H3,(H,19,20) |
| InChIKey | DATNTDVRWLFYLZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|