About 4-(1-chloroethylidene)-5-methyl-2,3-dihydropyrrole
4-(1-chloroethylidene)-5-methyl-2,3-dihydropyrrole (PubChem CID 71419624) has the molecular formula C7H10ClN
and a molecular weight of 143.62 g/mol. Its IUPAC name is 4-(1-chloroethylidene)-5-methyl-2,3-dihydropyrrole.
Molecular Properties
| Compound Name | 4-(1-chloroethylidene)-5-methyl-2,3-dihydropyrrole |
| PubChem CID | 71419624 |
| Molecular Formula | C7H10ClN |
| Molecular Weight | 143.62 g/mol |
| Exact Mass | 143.05 |
| IUPAC Name | 4-(1-chloroethylidene)-5-methyl-2,3-dihydropyrrole |
| SMILES | CC1=NCCC1=C(C)Cl |
| InChI | InChI=1S/C7H10ClN/c1-5(8)7-3-4-9-6(7)2/h3-4H2,1-2H3 |
| InChIKey | WRPNFRBPBDSBJR-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.62 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(1-chloroethylidene)-5-methyl-2,3-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-chloroethylidene)-5-methyl-2,3-dihydropyrrole?
The IUPAC name of 4-(1-chloroethylidene)-5-methyl-2,3-dihydropyrrole (CID 71419624) is 4-(1-chloroethylidene)-5-methyl-2,3-dihydropyrrole.
What is the SMILES notation for 4-(1-chloroethylidene)-5-methyl-2,3-dihydropyrrole?
The canonical SMILES for 4-(1-chloroethylidene)-5-methyl-2,3-dihydropyrrole is CC1=NCCC1=C(C)Cl.
What is the InChIKey of 4-(1-chloroethylidene)-5-methyl-2,3-dihydropyrrole?
The InChIKey is WRPNFRBPBDSBJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10ClN/c1-5(8)7-3-4-9-6(7)2/h3-4H2,1-2H3.
What are the key properties of 4-(1-chloroethylidene)-5-methyl-2,3-dihydropyrrole?
4-(1-chloroethylidene)-5-methyl-2,3-dihydropyrrole has a molecular weight of 143.62 g/mol, XLogP of 2.36, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-chloroethylidene)-5-methyl-2,3-dihydropyrrole is sourced from PubChem (CID 71419624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).