C16H24N2O2 — CID 71422083
6,7-dimethoxy-1-piperidin-3-yl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 71422083) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 6,7-dimethoxy-1-piperidin-3-yl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 6,7-dimethoxy-1-piperidin-3-yl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 71422083 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 6,7-dimethoxy-1-piperidin-3-yl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | COc1cc2c(cc1OC)C(C1CCCNC1)NCC2 |
| InChI | InChI=1S/C16H24N2O2/c1-19-14-8-11-5-7-18-16(12-4-3-6-17-10-12)13(11)9-15(14)20-2/h8-9,12,16-18H,3-7,10H2,1-2H3 |
| InChIKey | QEOIIGUERMBUGK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |