C9H14Cl2N2O2 — CID 71432875
(3S)-3-(pyridin-4-ylamino)butanoic acid;dihydrochloride (PubChem CID 71432875) has the molecular formula C9H14Cl2N2O2 and a molecular weight of 253.13 g/mol. Its IUPAC name is (3S)-3-(pyridin-4-ylamino)butanoic acid;dihydrochloride.
| Compound Name | (3S)-3-(pyridin-4-ylamino)butanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 71432875 |
| Molecular Formula | C9H14Cl2N2O2 |
| Molecular Weight | 253.13 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | (3S)-3-(pyridin-4-ylamino)butanoic acid;dihydrochloride |
| SMILES | C[C@@H](CC(=O)O)Nc1ccncc1.Cl.Cl |
| InChI | InChI=1S/C9H12N2O2.2ClH/c1-7(6-9(12)13)11-8-2-4-10-5-3-8;;/h2-5,7H,6H2,1H3,(H,10,11)(H,12,13);2*1H/t7-;;/m0../s1 |
| InChIKey | IYAGOKOFVNQOPW-KLXURFKVSA-N |
| XLogP | 2.20 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.13 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |