C14H19NO4 — CID 158430583
(3S)-3-anilinobutanoic acid;(4R)-4-methyloxetan-2-one (PubChem CID 158430583) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is (3S)-3-anilinobutanoic acid;(4R)-4-methyloxetan-2-one.
| Compound Name | (3S)-3-anilinobutanoic acid;(4R)-4-methyloxetan-2-one |
|---|---|
| PubChem CID | 158430583 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | (3S)-3-anilinobutanoic acid;(4R)-4-methyloxetan-2-one |
| SMILES | C[C@@H](CC(=O)O)Nc1ccccc1.C[C@@H]1CC(=O)O1 |
| InChI | InChI=1S/C10H13NO2.C4H6O2/c1-8(7-10(12)13)11-9-5-3-2-4-6-9;1-3-2-4(5)6-3/h2-6,8,11H,7H2,1H3,(H,12,13);3H,2H2,1H3/t8-;3-/m01/s1 |
| InChIKey | HBPLUKVYSMOOMR-KQFXGGHGSA-N |
| XLogP | 2.28 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|