C19H27NO — CID 42564400
(3S)-3-anilino-1-[(1R,2S)-2,6,6-trimethylcyclohex-3-en-1-yl]butan-1-one (PubChem CID 42564400) has the molecular formula C19H27NO and a molecular weight of 285.43 g/mol. Its IUPAC name is (3S)-3-anilino-1-[(1R,2S)-2,6,6-trimethylcyclohex-3-en-1-yl]butan-1-one.
| Compound Name | (3S)-3-anilino-1-[(1R,2S)-2,6,6-trimethylcyclohex-3-en-1-yl]butan-1-one |
|---|---|
| PubChem CID | 42564400 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | (3S)-3-anilino-1-[(1R,2S)-2,6,6-trimethylcyclohex-3-en-1-yl]butan-1-one |
| SMILES | C[C@@H](CC(=O)[C@@H]1[C@@H](C)C=CCC1(C)C)Nc1ccccc1 |
| InChI | InChI=1S/C19H27NO/c1-14-9-8-12-19(3,4)18(14)17(21)13-15(2)20-16-10-6-5-7-11-16/h5-11,14-15,18,20H,12-13H2,1-4H3/t14-,15-,18-/m0/s1 |
| InChIKey | DIZQNYFBYQDRTA-MPGHIAIKSA-N |
| XLogP | 4.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|